C30H26N4O3 — CID 10255007
2-[4-[3-[[[2-(1H-benzimidazol-2-yl)acetyl]-methylamino]methyl]phenyl]anilino]benzoic acid (PubChem CID 10255007) has the molecular formula C30H26N4O3 and a molecular weight of 490.56 g/mol. Its IUPAC name is 2-[4-[3-[[[2-(1H-benzimidazol-2-yl)acetyl]-methylamino]methyl]phenyl]anilino]benzoic acid.
| Compound Name | 2-[4-[3-[[[2-(1H-benzimidazol-2-yl)acetyl]-methylamino]methyl]phenyl]anilino]benzoic acid |
|---|---|
| PubChem CID | 10255007 |
| Molecular Formula | C30H26N4O3 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 2-[4-[3-[[[2-(1H-benzimidazol-2-yl)acetyl]-methylamino]methyl]phenyl]anilino]benzoic acid |
| SMILES | CN(Cc1cccc(-c2ccc(Nc3ccccc3C(=O)O)cc2)c1)C(=O)Cc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C30H26N4O3/c1-34(29(35)18-28-32-26-11-4-5-12-27(26)33-28)19-20-7-6-8-22(17-20)21-13-15-23(16-14-21)31-25-10-3-2-9-24(25)30(36)37/h2-17,31H,18-19H2,1H3,(H,32,33)(H,36,37) |
| InChIKey | ZXYAISAXHJWARO-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |