C29H33FN2O3 — CID 69416108
2-[4-[4-fluoro-3-[[methyl(octanoyl)amino]methyl]phenyl]anilino]benzoic acid (PubChem CID 69416108) has the molecular formula C29H33FN2O3 and a molecular weight of 476.59 g/mol. Its IUPAC name is 2-[4-[4-fluoro-3-[[methyl(octanoyl)amino]methyl]phenyl]anilino]benzoic acid.
| Compound Name | 2-[4-[4-fluoro-3-[[methyl(octanoyl)amino]methyl]phenyl]anilino]benzoic acid |
|---|---|
| PubChem CID | 69416108 |
| Molecular Formula | C29H33FN2O3 |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 2-[4-[4-fluoro-3-[[methyl(octanoyl)amino]methyl]phenyl]anilino]benzoic acid |
| SMILES | CCCCCCCC(=O)N(C)Cc1cc(-c2ccc(Nc3ccccc3C(=O)O)cc2)ccc1F |
| InChI | InChI=1S/C29H33FN2O3/c1-3-4-5-6-7-12-28(33)32(2)20-23-19-22(15-18-26(23)30)21-13-16-24(17-14-21)31-27-11-9-8-10-25(27)29(34)35/h8-11,13-19,31H,3-7,12,20H2,1-2H3,(H,34,35) |
| InChIKey | XJCDDSZGISYUEF-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|