C27H30N4O4 — CID 69417596
2-[4-[3-[[[4-(2,2-dimethylhydrazinyl)-4-oxobutanoyl]-methylamino]methyl]phenyl]anilino]benzoic acid (PubChem CID 69417596) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is 2-[4-[3-[[[4-(2,2-dimethylhydrazinyl)-4-oxobutanoyl]-methylamino]methyl]phenyl]anilino]benzoic acid.
| Compound Name | 2-[4-[3-[[[4-(2,2-dimethylhydrazinyl)-4-oxobutanoyl]-methylamino]methyl]phenyl]anilino]benzoic acid |
|---|---|
| PubChem CID | 69417596 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 2-[4-[3-[[[4-(2,2-dimethylhydrazinyl)-4-oxobutanoyl]-methylamino]methyl]phenyl]anilino]benzoic acid |
| SMILES | CN(C)NC(=O)CCC(=O)N(C)Cc1cccc(-c2ccc(Nc3ccccc3C(=O)O)cc2)c1 |
| InChI | InChI=1S/C27H30N4O4/c1-30(2)29-25(32)15-16-26(33)31(3)18-19-7-6-8-21(17-19)20-11-13-22(14-12-20)28-24-10-5-4-9-23(24)27(34)35/h4-14,17,28H,15-16,18H2,1-3H3,(H,29,32)(H,34,35) |
| InChIKey | PEPUYVWQCQKOSP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|