C27H30N4O2S2 — CID 1025513
2-[[(6S)-3-cyano-6-(2-methylbutan-2-yl)-5,6,7,8-tetrahydroquinolin-2-yl]sulfanyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 1025513) has the molecular formula C27H30N4O2S2 and a molecular weight of 506.70 g/mol. Its IUPAC name is 2-[[(6S)-3-cyano-6-(2-methylbutan-2-yl)-5,6,7,8-tetrahydroquinolin-2-yl]sulfanyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[[(6S)-3-cyano-6-(2-methylbutan-2-yl)-5,6,7,8-tetrahydroquinolin-2-yl]sulfanyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 1025513 |
| Molecular Formula | C27H30N4O2S2 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 2-[[(6S)-3-cyano-6-(2-methylbutan-2-yl)-5,6,7,8-tetrahydroquinolin-2-yl]sulfanyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CCC(C)(C)[C@H]1CCc2nc(SCC(=O)Nc3nc(-c4ccc(OC)cc4)cs3)c(C#N)cc2C1 |
| InChI | InChI=1S/C27H30N4O2S2/c1-5-27(2,3)20-8-11-22-18(13-20)12-19(14-28)25(29-22)34-16-24(32)31-26-30-23(15-35-26)17-6-9-21(33-4)10-7-17/h6-7,9-10,12,15,20H,5,8,11,13,16H2,1-4H3,(H,30,31,32)/t20-/m0/s1 |
| InChIKey | SVHBRMDXQVWFBF-FQEVSTJZSA-N |
| XLogP | 6.36 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |