C20H25N5OS3 — CID 125117671
2-[[(6S)-6-tert-butyl-3-cyano-5,6,7,8-tetrahydroquinolin-2-yl]sulfanyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 125117671) has the molecular formula C20H25N5OS3 and a molecular weight of 447.66 g/mol. Its IUPAC name is 2-[[(6S)-6-tert-butyl-3-cyano-5,6,7,8-tetrahydroquinolin-2-yl]sulfanyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[[(6S)-6-tert-butyl-3-cyano-5,6,7,8-tetrahydroquinolin-2-yl]sulfanyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 125117671 |
| Molecular Formula | C20H25N5OS3 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 2-[[(6S)-6-tert-butyl-3-cyano-5,6,7,8-tetrahydroquinolin-2-yl]sulfanyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCSc1nnc(NC(=O)CSc2nc3c(cc2C#N)C[C@@H](C(C)(C)C)CC3)s1 |
| InChI | InChI=1S/C20H25N5OS3/c1-5-27-19-25-24-18(29-19)23-16(26)11-28-17-13(10-21)8-12-9-14(20(2,3)4)6-7-15(12)22-17/h8,14H,5-7,9,11H2,1-4H3,(H,23,24,26)/t14-/m0/s1 |
| InChIKey | LZPOVPIQRBJELA-AWEZNQCLSA-N |
| XLogP | 4.80 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|