C23H25N5O4S — CID 28963297
N'-[2-[[(6R)-6-tert-butyl-3-cyano-5,6,7,8-tetrahydroquinolin-2-yl]sulfanyl]acetyl]-3-nitrobenzohydrazide (PubChem CID 28963297) has the molecular formula C23H25N5O4S and a molecular weight of 467.55 g/mol. Its IUPAC name is N'-[2-[[(6R)-6-tert-butyl-3-cyano-5,6,7,8-tetrahydroquinolin-2-yl]sulfanyl]acetyl]-3-nitrobenzohydrazide.
| Compound Name | N'-[2-[[(6R)-6-tert-butyl-3-cyano-5,6,7,8-tetrahydroquinolin-2-yl]sulfanyl]acetyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 28963297 |
| Molecular Formula | C23H25N5O4S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | N'-[2-[[(6R)-6-tert-butyl-3-cyano-5,6,7,8-tetrahydroquinolin-2-yl]sulfanyl]acetyl]-3-nitrobenzohydrazide |
| SMILES | CC(C)(C)[C@@H]1CCc2nc(SCC(=O)NNC(=O)c3cccc([N+](=O)[O-])c3)c(C#N)cc2C1 |
| InChI | InChI=1S/C23H25N5O4S/c1-23(2,3)17-7-8-19-15(10-17)9-16(12-24)22(25-19)33-13-20(29)26-27-21(30)14-5-4-6-18(11-14)28(31)32/h4-6,9,11,17H,7-8,10,13H2,1-3H3,(H,26,29)(H,27,30)/t17-/m1/s1 |
| InChIKey | IREYMUPQSUBQRP-QGZVFWFLSA-N |
| XLogP | 3.57 |
| TPSA | 138.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|