C10H10IN5S — CID 102552335
3-methyl-6-(1-methylpyridin-1-ium-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole iodide (PubChem CID 102552335) has the molecular formula C10H10IN5S and a molecular weight of 359.20 g/mol. Its IUPAC name is 3-methyl-6-(1-methylpyridin-1-ium-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole iodide.
| Compound Name | 3-methyl-6-(1-methylpyridin-1-ium-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole iodide |
|---|---|
| PubChem CID | 102552335 |
| Molecular Formula | C10H10IN5S |
| Molecular Weight | 359.20 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | 3-methyl-6-(1-methylpyridin-1-ium-3-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole iodide |
| SMILES | Cc1nnc2sc(-c3ccc[n+](C)c3)nn12.[I-] |
| InChI | InChI=1S/C10H10N5S.HI/c1-7-11-12-10-15(7)13-9(16-10)8-4-3-5-14(2)6-8;/h3-6H,1-2H3;1H/q+1;/p-1 |
| InChIKey | ZDTKLHSNYNGNOM-UHFFFAOYSA-M |
| XLogP | -2.01 |
| TPSA | 46.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.20 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|