C10H3F5N4S — CID 91678546
3-methyl-6-(2,3,4,5,6-pentafluorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 91678546) has the molecular formula C10H3F5N4S and a molecular weight of 306.22 g/mol. Its IUPAC name is 3-methyl-6-(2,3,4,5,6-pentafluorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-methyl-6-(2,3,4,5,6-pentafluorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 91678546 |
| Molecular Formula | C10H3F5N4S |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 3-methyl-6-(2,3,4,5,6-pentafluorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1nnc2sc(-c3c(F)c(F)c(F)c(F)c3F)nn12 |
| InChI | InChI=1S/C10H3F5N4S/c1-2-16-17-10-19(2)18-9(20-10)3-4(11)6(13)8(15)7(14)5(3)12/h1H3 |
| InChIKey | VFIHQRWUBNCYKP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|