C11H8F3N5S — CID 114351996
2-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-4-(trifluoromethyl)aniline (PubChem CID 114351996) has the molecular formula C11H8F3N5S and a molecular weight of 299.28 g/mol. Its IUPAC name is 2-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-4-(trifluoromethyl)aniline.
| Compound Name | 2-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 114351996 |
| Molecular Formula | C11H8F3N5S |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 2-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-4-(trifluoromethyl)aniline |
| SMILES | Cc1nnc2sc(-c3cc(C(F)(F)F)ccc3N)nn12 |
| InChI | InChI=1S/C11H8F3N5S/c1-5-16-17-10-19(5)18-9(20-10)7-4-6(11(12,13)14)2-3-8(7)15/h2-4H,15H2,1H3 |
| InChIKey | TTYRGRBKNDVCDH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|