C13H14BrN5S — CID 114353429
4-bromo-2-(3-tert-butyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline (PubChem CID 114353429) has the molecular formula C13H14BrN5S and a molecular weight of 352.26 g/mol. Its IUPAC name is 4-bromo-2-(3-tert-butyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline.
| Compound Name | 4-bromo-2-(3-tert-butyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline |
|---|---|
| PubChem CID | 114353429 |
| Molecular Formula | C13H14BrN5S |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 4-bromo-2-(3-tert-butyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline |
| SMILES | CC(C)(C)c1nnc2sc(-c3cc(Br)ccc3N)nn12 |
| InChI | InChI=1S/C13H14BrN5S/c1-13(2,3)11-16-17-12-19(11)18-10(20-12)8-6-7(14)4-5-9(8)15/h4-6H,15H2,1-3H3 |
| InChIKey | VMVBAQKAJVKRJJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|