C13H17N5S2 — CID 114353361
3-(3-tert-butyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-4,5-dimethylthiophen-2-amine (PubChem CID 114353361) has the molecular formula C13H17N5S2 and a molecular weight of 307.45 g/mol. Its IUPAC name is 3-(3-tert-butyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-4,5-dimethylthiophen-2-amine.
| Compound Name | 3-(3-tert-butyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-4,5-dimethylthiophen-2-amine |
|---|---|
| PubChem CID | 114353361 |
| Molecular Formula | C13H17N5S2 |
| Molecular Weight | 307.45 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 3-(3-tert-butyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-4,5-dimethylthiophen-2-amine |
| SMILES | Cc1sc(N)c(-c2nn3c(C(C)(C)C)nnc3s2)c1C |
| InChI | InChI=1S/C13H17N5S2/c1-6-7(2)19-9(14)8(6)10-17-18-11(13(3,4)5)15-16-12(18)20-10/h14H2,1-5H3 |
| InChIKey | NBMBTQQQXHEJCA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |