C14H9ClFN3O3 — CID 102554451
N-(3-chloro-4-fluorophenyl)-2-cyano-3-(5-methyl-1,3-oxazol-4-yl)-3-oxopropanamide (PubChem CID 102554451) has the molecular formula C14H9ClFN3O3 and a molecular weight of 321.70 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-cyano-3-(5-methyl-1,3-oxazol-4-yl)-3-oxopropanamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-cyano-3-(5-methyl-1,3-oxazol-4-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 102554451 |
| Molecular Formula | C14H9ClFN3O3 |
| Molecular Weight | 321.70 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-cyano-3-(5-methyl-1,3-oxazol-4-yl)-3-oxopropanamide |
| SMILES | Cc1ocnc1C(=O)C(C#N)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H9ClFN3O3/c1-7-12(18-6-22-7)13(20)9(5-17)14(21)19-8-2-3-11(16)10(15)4-8/h2-4,6,9H,1H3,(H,19,21) |
| InChIKey | VBDYQMNHIDSBSC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.70 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|