C18H20N2O5 — CID 102555852
[4-(2-oxoazepan-3-yl)oxyphenyl] 3,5-dimethyl-1,2-oxazole-4-carboxylate (PubChem CID 102555852) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is [4-(2-oxoazepan-3-yl)oxyphenyl] 3,5-dimethyl-1,2-oxazole-4-carboxylate.
| Compound Name | [4-(2-oxoazepan-3-yl)oxyphenyl] 3,5-dimethyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 102555852 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [4-(2-oxoazepan-3-yl)oxyphenyl] 3,5-dimethyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1noc(C)c1C(=O)Oc1ccc(OC2CCCCNC2=O)cc1 |
| InChI | InChI=1S/C18H20N2O5/c1-11-16(12(2)25-20-11)18(22)24-14-8-6-13(7-9-14)23-15-5-3-4-10-19-17(15)21/h6-9,15H,3-5,10H2,1-2H3,(H,19,21) |
| InChIKey | KGUGMFDJAZNOGP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|