C33H48O4 — CID 10255718
[(2R,6R)-2-(2-methylcyclohex-2-en-1-yl)-5-oxo-2H-pyran-6-yl]methyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate (PubChem CID 10255718) has the molecular formula C33H48O4 and a molecular weight of 508.74 g/mol. Its IUPAC name is [(2R,6R)-2-(2-methylcyclohex-2-en-1-yl)-5-oxo-2H-pyran-6-yl]methyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate.
| Compound Name | [(2R,6R)-2-(2-methylcyclohex-2-en-1-yl)-5-oxo-2H-pyran-6-yl]methyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 10255718 |
| Molecular Formula | C33H48O4 |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.36 |
| IUPAC Name | [(2R,6R)-2-(2-methylcyclohex-2-en-1-yl)-5-oxo-2H-pyran-6-yl]methyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OC[C@H]1O[C@@H](C2CCCC=C2C)C=CC1=O |
| InChI | InChI=1S/C33H48O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24-33(35)36-27-32-30(34)25-26-31(37-32)29-23-21-20-22-28(29)2/h7-8,10-11,13-14,16-17,22,25-26,29,31-32H,3-6,9,12,15,18-21,23-24,27H2,1-2H3/b8-7-,11-10-,14-13-,17-16-/t29?,31-,32-/m1/s1 |
| InChIKey | TWKGXAQLQQTMNO-PTEFMFNXSA-N |
| XLogP | 8.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|