C17H24O4 — CID 44376021
[(2S,6R)-2-(2-methylcyclohex-2-en-1-yl)-5-oxo-2H-pyran-6-yl]methyl butanoate (PubChem CID 44376021) has the molecular formula C17H24O4 and a molecular weight of 292.40 g/mol. Its IUPAC name is [(2S,6R)-2-(2-methylcyclohex-2-en-1-yl)-5-oxo-2H-pyran-6-yl]methyl butanoate.
| Compound Name | [(2S,6R)-2-(2-methylcyclohex-2-en-1-yl)-5-oxo-2H-pyran-6-yl]methyl butanoate |
|---|---|
| PubChem CID | 44376021 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [(2S,6R)-2-(2-methylcyclohex-2-en-1-yl)-5-oxo-2H-pyran-6-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@@H]1C(=O)C=C[C@H](O1)C2CCCC=C2C |
| InChI | InChI=1S/C17H24O4/c1-3-6-17(19)20-11-16-14(18)9-10-15(21-16)13-8-5-4-7-12(13)2/h7,9-10,13,15-16H,3-6,8,11H2,1-2H3/t13?,15-,16+/m0/s1 |
| InChIKey | WSVDRCANNYMDHI-PXWJKWRZSA-N |
| XLogP | 2.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | 450 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|