C24H21NO5 — CID 102557258
N-[(2-hydroxy-5-methoxyphenyl)methyl]-1-oxo-3-phenyl-3,4-dihydroisochromene-6-carboxamide (PubChem CID 102557258) has the molecular formula C24H21NO5 and a molecular weight of 403.43 g/mol. Its IUPAC name is N-[(2-hydroxy-5-methoxyphenyl)methyl]-1-oxo-3-phenyl-3,4-dihydroisochromene-6-carboxamide.
| Compound Name | N-[(2-hydroxy-5-methoxyphenyl)methyl]-1-oxo-3-phenyl-3,4-dihydroisochromene-6-carboxamide |
|---|---|
| PubChem CID | 102557258 |
| Molecular Formula | C24H21NO5 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-[(2-hydroxy-5-methoxyphenyl)methyl]-1-oxo-3-phenyl-3,4-dihydroisochromene-6-carboxamide |
| SMILES | COc1ccc(O)c(CNC(=O)c2ccc3c(c2)CC(c2ccccc2)OC3=O)c1 |
| InChI | InChI=1S/C24H21NO5/c1-29-19-8-10-21(26)18(12-19)14-25-23(27)16-7-9-20-17(11-16)13-22(30-24(20)28)15-5-3-2-4-6-15/h2-12,22,26H,13-14H2,1H3,(H,25,27) |
| InChIKey | MDDSYYODOINMDV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|