C25H23NO3S — CID 8012766
(3R)-1-oxo-3-phenyl-N-(3-phenylsulfanylpropyl)-3,4-dihydroisochromene-6-carboxamide (PubChem CID 8012766) has the molecular formula C25H23NO3S and a molecular weight of 417.53 g/mol. Its IUPAC name is (3R)-1-oxo-3-phenyl-N-(3-phenylsulfanylpropyl)-3,4-dihydroisochromene-6-carboxamide.
| Compound Name | (3R)-1-oxo-3-phenyl-N-(3-phenylsulfanylpropyl)-3,4-dihydroisochromene-6-carboxamide |
|---|---|
| PubChem CID | 8012766 |
| Molecular Formula | C25H23NO3S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | (3R)-1-oxo-3-phenyl-N-(3-phenylsulfanylpropyl)-3,4-dihydroisochromene-6-carboxamide |
| SMILES | O=C(NCCCSc1ccccc1)c1ccc2c(c1)C[C@H](c1ccccc1)OC2=O |
| InChI | InChI=1S/C25H23NO3S/c27-24(26-14-7-15-30-21-10-5-2-6-11-21)19-12-13-22-20(16-19)17-23(29-25(22)28)18-8-3-1-4-9-18/h1-6,8-13,16,23H,7,14-15,17H2,(H,26,27)/t23-/m1/s1 |
| InChIKey | KWBBAKHYQDXYPS-HSZRJFAPSA-N |
| XLogP | 5.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|