C16H26N6O3 — CID 102557756
1-(1-methyl-6-oxopiperidin-3-yl)-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]urea (PubChem CID 102557756) has the molecular formula C16H26N6O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-(1-methyl-6-oxopiperidin-3-yl)-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]urea.
| Compound Name | 1-(1-methyl-6-oxopiperidin-3-yl)-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]urea |
|---|---|
| PubChem CID | 102557756 |
| Molecular Formula | C16H26N6O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 1-(1-methyl-6-oxopiperidin-3-yl)-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]urea |
| SMILES | CN1CC(NC(=O)NCCCn2nc3n(c2=O)CCCC3)CCC1=O |
| InChI | InChI=1S/C16H26N6O3/c1-20-11-12(6-7-14(20)23)18-15(24)17-8-4-10-22-16(25)21-9-3-2-5-13(21)19-22/h12H,2-11H2,1H3,(H2,17,18,24) |
| InChIKey | PFPHEZWPXIAAJN-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|