C17H21F2NO4 — CID 102558220
oxan-2-ylmethyl 2,4-difluoro-5-(2-methylpropanoylamino)benzoate (PubChem CID 102558220) has the molecular formula C17H21F2NO4 and a molecular weight of 341.35 g/mol. Its IUPAC name is oxan-2-ylmethyl 2,4-difluoro-5-(2-methylpropanoylamino)benzoate.
| Compound Name | oxan-2-ylmethyl 2,4-difluoro-5-(2-methylpropanoylamino)benzoate |
|---|---|
| PubChem CID | 102558220 |
| Molecular Formula | C17H21F2NO4 |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | oxan-2-ylmethyl 2,4-difluoro-5-(2-methylpropanoylamino)benzoate |
| SMILES | CC(C)C(=O)Nc1cc(C(=O)OCC2CCCCO2)c(F)cc1F |
| InChI | InChI=1S/C17H21F2NO4/c1-10(2)16(21)20-15-7-12(13(18)8-14(15)19)17(22)24-9-11-5-3-4-6-23-11/h7-8,10-11H,3-6,9H2,1-2H3,(H,20,21) |
| InChIKey | WGROJDXUGCZXOD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |