C20H28N4O3S — CID 102558605
N-[(1-benzylpyrrolidin-3-yl)methyl]-N-ethyl-1-methyl-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 102558605) has the molecular formula C20H28N4O3S and a molecular weight of 404.54 g/mol. Its IUPAC name is N-[(1-benzylpyrrolidin-3-yl)methyl]-N-ethyl-1-methyl-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | N-[(1-benzylpyrrolidin-3-yl)methyl]-N-ethyl-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 102558605 |
| Molecular Formula | C20H28N4O3S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N-[(1-benzylpyrrolidin-3-yl)methyl]-N-ethyl-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | CCN(CC1CCN(Cc2ccccc2)C1)C(=O)c1cc(S(N)(=O)=O)cn1C |
| InChI | InChI=1S/C20H28N4O3S/c1-3-24(20(25)19-11-18(15-22(19)2)28(21,26)27)14-17-9-10-23(13-17)12-16-7-5-4-6-8-16/h4-8,11,15,17H,3,9-10,12-14H2,1-2H3,(H2,21,26,27) |
| InChIKey | BDEAKUSBFYUAKV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 88.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |