C10H15N3O5S — CID 61022936
2-[ethyl-(1-methyl-4-sulfamoylpyrrole-2-carbonyl)amino]acetic acid (PubChem CID 61022936) has the molecular formula C10H15N3O5S and a molecular weight of 289.31 g/mol. Its IUPAC name is 2-[ethyl-(1-methyl-4-sulfamoylpyrrole-2-carbonyl)amino]acetic acid.
| Compound Name | 2-[ethyl-(1-methyl-4-sulfamoylpyrrole-2-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 61022936 |
| Molecular Formula | C10H15N3O5S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-[ethyl-(1-methyl-4-sulfamoylpyrrole-2-carbonyl)amino]acetic acid |
| SMILES | CCN(CC(=O)O)C(=O)c1cc(S(N)(=O)=O)cn1C |
| InChI | InChI=1S/C10H15N3O5S/c1-3-13(6-9(14)15)10(16)8-4-7(5-12(8)2)19(11,17)18/h4-5H,3,6H2,1-2H3,(H,14,15)(H2,11,17,18) |
| InChIKey | MCXKFJPFSVURLU-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 122.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |