C13H21N3O3S — CID 65387791
N-cyclopentyl-N-ethyl-1-methyl-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 65387791) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is N-cyclopentyl-N-ethyl-1-methyl-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | N-cyclopentyl-N-ethyl-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 65387791 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-cyclopentyl-N-ethyl-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | CCN(C(=O)c1cc(S(N)(=O)=O)cn1C)C1CCCC1 |
| InChI | InChI=1S/C13H21N3O3S/c1-3-16(10-6-4-5-7-10)13(17)12-8-11(9-15(12)2)20(14,18)19/h8-10H,3-7H2,1-2H3,(H2,14,18,19) |
| InChIKey | ANHCXRSNCLPLTN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |