C17H22N4O4S — CID 31518280
N-[3-(diethylcarbamoyl)phenyl]-1-methyl-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 31518280) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is N-[3-(diethylcarbamoyl)phenyl]-1-methyl-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | N-[3-(diethylcarbamoyl)phenyl]-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 31518280 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[3-(diethylcarbamoyl)phenyl]-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)c2cc(S(N)(=O)=O)cn2C)c1 |
| InChI | InChI=1S/C17H22N4O4S/c1-4-21(5-2)17(23)12-7-6-8-13(9-12)19-16(22)15-10-14(11-20(15)3)26(18,24)25/h6-11H,4-5H2,1-3H3,(H,19,22)(H2,18,24,25) |
| InChIKey | QBZJFCXZEQMYBH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |