C13H11FN4O3S — CID 126493643
N-(3-cyano-4-fluorophenyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 126493643) has the molecular formula C13H11FN4O3S and a molecular weight of 322.32 g/mol. Its IUPAC name is N-(3-cyano-4-fluorophenyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | N-(3-cyano-4-fluorophenyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 126493643 |
| Molecular Formula | C13H11FN4O3S |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | N-(3-cyano-4-fluorophenyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(N)(=O)=O)cc1C(=O)Nc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C13H11FN4O3S/c1-18-7-10(22(16,20)21)5-12(18)13(19)17-9-2-3-11(14)8(4-9)6-15/h2-5,7H,1H3,(H,17,19)(H2,16,20,21) |
| InChIKey | GJFBIDYUZAOMPB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |