C17H15FN4O3 — CID 139551632
N-(3-cyano-4-fluorophenyl)-5-[2-(ethylamino)-2-oxoacetyl]-1-methylpyrrole-3-carboxamide (PubChem CID 139551632) has the molecular formula C17H15FN4O3 and a molecular weight of 342.33 g/mol. Its IUPAC name is N-(3-cyano-4-fluorophenyl)-5-[2-(ethylamino)-2-oxoacetyl]-1-methylpyrrole-3-carboxamide.
| Compound Name | N-(3-cyano-4-fluorophenyl)-5-[2-(ethylamino)-2-oxoacetyl]-1-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 139551632 |
| Molecular Formula | C17H15FN4O3 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | N-(3-cyano-4-fluorophenyl)-5-[2-(ethylamino)-2-oxoacetyl]-1-methylpyrrole-3-carboxamide |
| SMILES | CCNC(=O)C(=O)c1cc(C(=O)Nc2ccc(F)c(C#N)c2)cn1C |
| InChI | InChI=1S/C17H15FN4O3/c1-3-20-17(25)15(23)14-7-11(9-22(14)2)16(24)21-12-4-5-13(18)10(6-12)8-19/h4-7,9H,3H2,1-2H3,(H,20,25)(H,21,24) |
| InChIKey | MWSJTKYDOXFBCT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|