C16H12F2N4O3 — CID 153419420
N-(3,4-difluorophenyl)-4-[2-(isocyanomethylamino)-2-oxoacetyl]-1-methylpyrrole-2-carboxamide (PubChem CID 153419420) has the molecular formula C16H12F2N4O3 and a molecular weight of 346.29 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-4-[2-(isocyanomethylamino)-2-oxoacetyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-4-[2-(isocyanomethylamino)-2-oxoacetyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 153419420 |
| Molecular Formula | C16H12F2N4O3 |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-(3,4-difluorophenyl)-4-[2-(isocyanomethylamino)-2-oxoacetyl]-1-methylpyrrole-2-carboxamide |
| SMILES | [C-]#[N+]CNC(=O)C(=O)c1cc(C(=O)Nc2ccc(F)c(F)c2)n(C)c1 |
| InChI | InChI=1S/C16H12F2N4O3/c1-19-8-20-16(25)14(23)9-5-13(22(2)7-9)15(24)21-10-3-4-11(17)12(18)6-10/h3-7H,8H2,2H3,(H,20,25)(H,21,24) |
| InChIKey | AHSNLQAQLBLANF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|