C20H20FN5O3 — CID 157060203
N-(4-fluoro-3-methylphenyl)-1-methyl-4-[2-oxo-4-(2H-triazol-4-yl)pentanoyl]pyrrole-2-carboxamide (PubChem CID 157060203) has the molecular formula C20H20FN5O3 and a molecular weight of 397.41 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-1-methyl-4-[2-oxo-4-(2H-triazol-4-yl)pentanoyl]pyrrole-2-carboxamide.
| Compound Name | N-(4-fluoro-3-methylphenyl)-1-methyl-4-[2-oxo-4-(2H-triazol-4-yl)pentanoyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 157060203 |
| Molecular Formula | C20H20FN5O3 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-1-methyl-4-[2-oxo-4-(2H-triazol-4-yl)pentanoyl]pyrrole-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cc(C(=O)C(=O)CC(C)c3cn[nH]n3)cn2C)ccc1F |
| InChI | InChI=1S/C20H20FN5O3/c1-11-6-14(4-5-15(11)21)23-20(29)17-8-13(10-26(17)3)19(28)18(27)7-12(2)16-9-22-25-24-16/h4-6,8-10,12H,7H2,1-3H3,(H,23,29)(H,22,24,25) |
| InChIKey | ABFZLBGIDOQGDZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|