C18H12F4N4O2 — CID 29097127
3-N,5-N-bis(3,4-difluorophenyl)-1-methylpyrazole-3,5-dicarboxamide (PubChem CID 29097127) has the molecular formula C18H12F4N4O2 and a molecular weight of 392.31 g/mol. Its IUPAC name is 3-N,5-N-bis(3,4-difluorophenyl)-1-methylpyrazole-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-bis(3,4-difluorophenyl)-1-methylpyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 29097127 |
| Molecular Formula | C18H12F4N4O2 |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 3-N,5-N-bis(3,4-difluorophenyl)-1-methylpyrazole-3,5-dicarboxamide |
| SMILES | Cn1nc(C(=O)Nc2ccc(F)c(F)c2)cc1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H12F4N4O2/c1-26-16(18(28)24-10-3-5-12(20)14(22)7-10)8-15(25-26)17(27)23-9-2-4-11(19)13(21)6-9/h2-8H,1H3,(H,23,27)(H,24,28) |
| InChIKey | VTDDIJYTDHJEMD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |