C20H19FN4O3 — CID 158387178
N-(4-fluoro-3-isocyanophenyl)-1-methyl-5-[2-[(1-methylcyclobutyl)amino]-2-oxoacetyl]pyrrole-3-carboxamide (PubChem CID 158387178) has the molecular formula C20H19FN4O3 and a molecular weight of 382.40 g/mol. Its IUPAC name is N-(4-fluoro-3-isocyanophenyl)-1-methyl-5-[2-[(1-methylcyclobutyl)amino]-2-oxoacetyl]pyrrole-3-carboxamide.
| Compound Name | N-(4-fluoro-3-isocyanophenyl)-1-methyl-5-[2-[(1-methylcyclobutyl)amino]-2-oxoacetyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 158387178 |
| Molecular Formula | C20H19FN4O3 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | N-(4-fluoro-3-isocyanophenyl)-1-methyl-5-[2-[(1-methylcyclobutyl)amino]-2-oxoacetyl]pyrrole-3-carboxamide |
| SMILES | [C-]#[N+]c1cc(NC(=O)c2cc(C(=O)C(=O)NC3(C)CCC3)n(C)c2)ccc1F |
| InChI | InChI=1S/C20H19FN4O3/c1-20(7-4-8-20)24-19(28)17(26)16-9-12(11-25(16)3)18(27)23-13-5-6-14(21)15(10-13)22-2/h5-6,9-11H,4,7-8H2,1,3H3,(H,23,27)(H,24,28) |
| InChIKey | ZNPDSISIRPICNK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|