C22H21F4N3O3 — CID 146535123
3-[2-[(3,3-difluoro-1-methylcyclobutyl)amino]-2-oxoacetyl]-N-(3,4-difluorophenyl)-5,6,7,8-tetrahydroindolizine-1-carboxamide (PubChem CID 146535123) has the molecular formula C22H21F4N3O3 and a molecular weight of 451.42 g/mol. Its IUPAC name is 3-[2-[(3,3-difluoro-1-methylcyclobutyl)amino]-2-oxoacetyl]-N-(3,4-difluorophenyl)-5,6,7,8-tetrahydroindolizine-1-carboxamide.
| Compound Name | 3-[2-[(3,3-difluoro-1-methylcyclobutyl)amino]-2-oxoacetyl]-N-(3,4-difluorophenyl)-5,6,7,8-tetrahydroindolizine-1-carboxamide |
|---|---|
| PubChem CID | 146535123 |
| Molecular Formula | C22H21F4N3O3 |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 3-[2-[(3,3-difluoro-1-methylcyclobutyl)amino]-2-oxoacetyl]-N-(3,4-difluorophenyl)-5,6,7,8-tetrahydroindolizine-1-carboxamide |
| SMILES | CC1(NC(=O)C(=O)c2cc(C(=O)Nc3ccc(F)c(F)c3)c3n2CCCC3)CC(F)(F)C1 |
| InChI | InChI=1S/C22H21F4N3O3/c1-21(10-22(25,26)11-21)28-20(32)18(30)17-9-13(16-4-2-3-7-29(16)17)19(31)27-12-5-6-14(23)15(24)8-12/h5-6,8-9H,2-4,7,10-11H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | IKGUMFJSODKJNF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|