C15H13ClF2N2O4S — CID 146496069
2-chloro-3-[(3,4-difluorophenyl)carbamoyl]-5,6,7,8-tetrahydroindolizine-1-sulfonic acid (PubChem CID 146496069) has the molecular formula C15H13ClF2N2O4S and a molecular weight of 390.80 g/mol. Its IUPAC name is 2-chloro-3-[(3,4-difluorophenyl)carbamoyl]-5,6,7,8-tetrahydroindolizine-1-sulfonic acid.
| Compound Name | 2-chloro-3-[(3,4-difluorophenyl)carbamoyl]-5,6,7,8-tetrahydroindolizine-1-sulfonic acid |
|---|---|
| PubChem CID | 146496069 |
| Molecular Formula | C15H13ClF2N2O4S |
| Molecular Weight | 390.80 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 2-chloro-3-[(3,4-difluorophenyl)carbamoyl]-5,6,7,8-tetrahydroindolizine-1-sulfonic acid |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1c(Cl)c(S(=O)(=O)O)c2n1CCCC2 |
| InChI | InChI=1S/C15H13ClF2N2O4S/c16-12-13(15(21)19-8-4-5-9(17)10(18)7-8)20-6-2-1-3-11(20)14(12)25(22,23)24/h4-5,7H,1-3,6H2,(H,19,21)(H,22,23,24) |
| InChIKey | OZIRKVMTNPRGRJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.80 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|