C21H22F4N4O3S — CID 155278665
N-(3-cyano-4-fluorophenyl)-2-methyl-1-(1,1,1-trifluoropropan-2-ylsulfamoyl)-6,7,8,9-tetrahydro-5H-pyrrolo[1,2-a]azepine-3-carboxamide (PubChem CID 155278665) has the molecular formula C21H22F4N4O3S and a molecular weight of 486.49 g/mol. Its IUPAC name is N-(3-cyano-4-fluorophenyl)-2-methyl-1-(1,1,1-trifluoropropan-2-ylsulfamoyl)-6,7,8,9-tetrahydro-5H-pyrrolo[1,2-a]azepine-3-carboxamide.
| Compound Name | N-(3-cyano-4-fluorophenyl)-2-methyl-1-(1,1,1-trifluoropropan-2-ylsulfamoyl)-6,7,8,9-tetrahydro-5H-pyrrolo[1,2-a]azepine-3-carboxamide |
|---|---|
| PubChem CID | 155278665 |
| Molecular Formula | C21H22F4N4O3S |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | N-(3-cyano-4-fluorophenyl)-2-methyl-1-(1,1,1-trifluoropropan-2-ylsulfamoyl)-6,7,8,9-tetrahydro-5H-pyrrolo[1,2-a]azepine-3-carboxamide |
| SMILES | Cc1c(S(=O)(=O)NC(C)C(F)(F)F)c2n(c1C(=O)Nc1ccc(F)c(C#N)c1)CCCCC2 |
| InChI | InChI=1S/C21H22F4N4O3S/c1-12-18(20(30)27-15-7-8-16(22)14(10-15)11-26)29-9-5-3-4-6-17(29)19(12)33(31,32)28-13(2)21(23,24)25/h7-8,10,13,28H,3-6,9H2,1-2H3,(H,27,30) |
| InChIKey | FCUNJYXZANEKHF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |