C23H22F3N3O2S — CID 162613069
3-[2-cyano-2-(thiolan-1-ylidene)acetyl]-N-[3-(difluoromethyl)-4-fluorophenyl]-2-methyl-6,7-dihydro-5H-pyrrolizine-1-carboxamide (PubChem CID 162613069) has the molecular formula C23H22F3N3O2S and a molecular weight of 461.51 g/mol. Its IUPAC name is 3-[2-cyano-2-(thiolan-1-ylidene)acetyl]-N-[3-(difluoromethyl)-4-fluorophenyl]-2-methyl-6,7-dihydro-5H-pyrrolizine-1-carboxamide.
| Compound Name | 3-[2-cyano-2-(thiolan-1-ylidene)acetyl]-N-[3-(difluoromethyl)-4-fluorophenyl]-2-methyl-6,7-dihydro-5H-pyrrolizine-1-carboxamide |
|---|---|
| PubChem CID | 162613069 |
| Molecular Formula | C23H22F3N3O2S |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 3-[2-cyano-2-(thiolan-1-ylidene)acetyl]-N-[3-(difluoromethyl)-4-fluorophenyl]-2-methyl-6,7-dihydro-5H-pyrrolizine-1-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(F)c(C(F)F)c2)c2n(c1C(=O)C(C#N)=S1CCCC1)CCC2 |
| InChI | InChI=1S/C23H22F3N3O2S/c1-13-19(23(31)28-14-6-7-16(24)15(11-14)22(25)26)17-5-4-8-29(17)20(13)21(30)18(12-27)32-9-2-3-10-32/h6-7,11,22H,2-5,8-10H2,1H3,(H,28,31) |
| InChIKey | JOWSPZGIWFWEOV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|