C22H24FN5O3 — CID 155767943
N-(4-fluoro-3-isocyanophenyl)-1,2,4-trimethyl-5-[2-(4-methylpiperazin-1-yl)-2-oxoacetyl]pyrrole-3-carboxamide (PubChem CID 155767943) has the molecular formula C22H24FN5O3 and a molecular weight of 425.46 g/mol. Its IUPAC name is N-(4-fluoro-3-isocyanophenyl)-1,2,4-trimethyl-5-[2-(4-methylpiperazin-1-yl)-2-oxoacetyl]pyrrole-3-carboxamide.
| Compound Name | N-(4-fluoro-3-isocyanophenyl)-1,2,4-trimethyl-5-[2-(4-methylpiperazin-1-yl)-2-oxoacetyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 155767943 |
| Molecular Formula | C22H24FN5O3 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | N-(4-fluoro-3-isocyanophenyl)-1,2,4-trimethyl-5-[2-(4-methylpiperazin-1-yl)-2-oxoacetyl]pyrrole-3-carboxamide |
| SMILES | [C-]#[N+]c1cc(NC(=O)c2c(C)c(C(=O)C(=O)N3CCN(C)CC3)n(C)c2C)ccc1F |
| InChI | InChI=1S/C22H24FN5O3/c1-13-18(21(30)25-15-6-7-16(23)17(12-15)24-3)14(2)27(5)19(13)20(29)22(31)28-10-8-26(4)9-11-28/h6-7,12H,8-11H2,1-2,4-5H3,(H,25,30) |
| InChIKey | JZADNTDCNNKGAF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 79.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|