C22H17F4N3O3 — CID 146450352
5-[2-(3,4-difluoroanilino)-2-oxoacetyl]-N-(3,4-difluorophenyl)-1,2,4-trimethylpyrrole-3-carboxamide (PubChem CID 146450352) has the molecular formula C22H17F4N3O3 and a molecular weight of 447.39 g/mol. Its IUPAC name is 5-[2-(3,4-difluoroanilino)-2-oxoacetyl]-N-(3,4-difluorophenyl)-1,2,4-trimethylpyrrole-3-carboxamide.
| Compound Name | 5-[2-(3,4-difluoroanilino)-2-oxoacetyl]-N-(3,4-difluorophenyl)-1,2,4-trimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 146450352 |
| Molecular Formula | C22H17F4N3O3 |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 5-[2-(3,4-difluoroanilino)-2-oxoacetyl]-N-(3,4-difluorophenyl)-1,2,4-trimethylpyrrole-3-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(F)c(F)c2)c(C)n(C)c1C(=O)C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H17F4N3O3/c1-10-18(21(31)27-12-4-6-14(23)16(25)8-12)11(2)29(3)19(10)20(30)22(32)28-13-5-7-15(24)17(26)9-13/h4-9H,1-3H3,(H,27,31)(H,28,32) |
| InChIKey | JOWRNEYXPSWQRU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|