C20H23F2N3O4 — CID 146476276
5-[2-(tert-butylamino)-2-oxoacetyl]-N-(3,4-difluorophenyl)-4-methoxy-1,2-dimethylpyrrole-3-carboxamide (PubChem CID 146476276) has the molecular formula C20H23F2N3O4 and a molecular weight of 407.42 g/mol. Its IUPAC name is 5-[2-(tert-butylamino)-2-oxoacetyl]-N-(3,4-difluorophenyl)-4-methoxy-1,2-dimethylpyrrole-3-carboxamide.
| Compound Name | 5-[2-(tert-butylamino)-2-oxoacetyl]-N-(3,4-difluorophenyl)-4-methoxy-1,2-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 146476276 |
| Molecular Formula | C20H23F2N3O4 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 5-[2-(tert-butylamino)-2-oxoacetyl]-N-(3,4-difluorophenyl)-4-methoxy-1,2-dimethylpyrrole-3-carboxamide |
| SMILES | COc1c(C(=O)Nc2ccc(F)c(F)c2)c(C)n(C)c1C(=O)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C20H23F2N3O4/c1-10-14(18(27)23-11-7-8-12(21)13(22)9-11)17(29-6)15(25(10)5)16(26)19(28)24-20(2,3)4/h7-9H,1-6H3,(H,23,27)(H,24,28) |
| InChIKey | IEMQANQSGBNAJE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|