C19H22F2N3O7P — CID 146512569
3-[[2-[5-[(3,4-difluorophenyl)carbamoyl]-1,2,4-trimethylpyrrol-3-yl]-2-oxoacetyl]amino]propyl dihydrogen phosphate (PubChem CID 146512569) has the molecular formula C19H22F2N3O7P and a molecular weight of 473.37 g/mol. Its IUPAC name is 3-[[2-[5-[(3,4-difluorophenyl)carbamoyl]-1,2,4-trimethylpyrrol-3-yl]-2-oxoacetyl]amino]propyl dihydrogen phosphate.
| Compound Name | 3-[[2-[5-[(3,4-difluorophenyl)carbamoyl]-1,2,4-trimethylpyrrol-3-yl]-2-oxoacetyl]amino]propyl dihydrogen phosphate |
|---|---|
| PubChem CID | 146512569 |
| Molecular Formula | C19H22F2N3O7P |
| Molecular Weight | 473.37 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 3-[[2-[5-[(3,4-difluorophenyl)carbamoyl]-1,2,4-trimethylpyrrol-3-yl]-2-oxoacetyl]amino]propyl dihydrogen phosphate |
| SMILES | Cc1c(C(=O)C(=O)NCCCOP(=O)(O)O)c(C)n(C)c1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H22F2N3O7P/c1-10-15(17(25)19(27)22-7-4-8-31-32(28,29)30)11(2)24(3)16(10)18(26)23-12-5-6-13(20)14(21)9-12/h5-6,9H,4,7-8H2,1-3H3,(H,22,27)(H,23,26)(H2,28,29,30) |
| InChIKey | MYRFYPOVYMILHO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 146.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|