C24H28FN2O6P — CID 163759682
4-[4-[[dihydroxy(methylidene)-λ5-phosphanyl]oxymethyl]-4-methyl-2-oxohex-5-ynoyl]-N-(4-fluoro-3-methylphenyl)-1,3,5-trimethylpyrrole-2-carboxamide (PubChem CID 163759682) has the molecular formula C24H28FN2O6P and a molecular weight of 490.47 g/mol. Its IUPAC name is 4-[4-[[dihydroxy(methylidene)-λ5-phosphanyl]oxymethyl]-4-methyl-2-oxohex-5-ynoyl]-N-(4-fluoro-3-methylphenyl)-1,3,5-trimethylpyrrole-2-carboxamide.
| Compound Name | 4-[4-[[dihydroxy(methylidene)-λ5-phosphanyl]oxymethyl]-4-methyl-2-oxohex-5-ynoyl]-N-(4-fluoro-3-methylphenyl)-1,3,5-trimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 163759682 |
| Molecular Formula | C24H28FN2O6P |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 4-[4-[[dihydroxy(methylidene)-λ5-phosphanyl]oxymethyl]-4-methyl-2-oxohex-5-ynoyl]-N-(4-fluoro-3-methylphenyl)-1,3,5-trimethylpyrrole-2-carboxamide |
| SMILES | C#CC(C)(COP(=C)(O)O)CC(=O)C(=O)c1c(C)c(C(=O)Nc2ccc(F)c(C)c2)n(C)c1C |
| InChI | InChI=1S/C24H28FN2O6P/c1-8-24(5,13-33-34(7,31)32)12-19(28)22(29)20-15(3)21(27(6)16(20)4)23(30)26-17-9-10-18(25)14(2)11-17/h1,9-11,31-32H,7,12-13H2,2-6H3,(H,26,30) |
| InChIKey | VPHUHZRKTRNUDG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|