C21H21ClFN3O3 — CID 158199291
3-chloro-N-(3-cyano-4-fluorophenyl)-4-(4,4-dimethyl-2-oxopentanoyl)-1,5-dimethylpyrrole-2-carboxamide (PubChem CID 158199291) has the molecular formula C21H21ClFN3O3 and a molecular weight of 417.87 g/mol. Its IUPAC name is 3-chloro-N-(3-cyano-4-fluorophenyl)-4-(4,4-dimethyl-2-oxopentanoyl)-1,5-dimethylpyrrole-2-carboxamide.
| Compound Name | 3-chloro-N-(3-cyano-4-fluorophenyl)-4-(4,4-dimethyl-2-oxopentanoyl)-1,5-dimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 158199291 |
| Molecular Formula | C21H21ClFN3O3 |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 3-chloro-N-(3-cyano-4-fluorophenyl)-4-(4,4-dimethyl-2-oxopentanoyl)-1,5-dimethylpyrrole-2-carboxamide |
| SMILES | Cc1c(C(=O)C(=O)CC(C)(C)C)c(Cl)c(C(=O)Nc2ccc(F)c(C#N)c2)n1C |
| InChI | InChI=1S/C21H21ClFN3O3/c1-11-16(19(28)15(27)9-21(2,3)4)17(22)18(26(11)5)20(29)25-13-6-7-14(23)12(8-13)10-24/h6-8H,9H2,1-5H3,(H,25,29) |
| InChIKey | GASSFEPGGXDULW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 91.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|