C24H22ClF2N3O3 — CID 159803165
3-chloro-N-(3-cyano-4-methylphenyl)-4-[3-(1-ethenyl-3,3-difluorocyclobutyl)-2-oxopropanoyl]-1,5-dimethylpyrrole-2-carboxamide (PubChem CID 159803165) has the molecular formula C24H22ClF2N3O3 and a molecular weight of 473.91 g/mol. Its IUPAC name is 3-chloro-N-(3-cyano-4-methylphenyl)-4-[3-(1-ethenyl-3,3-difluorocyclobutyl)-2-oxopropanoyl]-1,5-dimethylpyrrole-2-carboxamide.
| Compound Name | 3-chloro-N-(3-cyano-4-methylphenyl)-4-[3-(1-ethenyl-3,3-difluorocyclobutyl)-2-oxopropanoyl]-1,5-dimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 159803165 |
| Molecular Formula | C24H22ClF2N3O3 |
| Molecular Weight | 473.91 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 3-chloro-N-(3-cyano-4-methylphenyl)-4-[3-(1-ethenyl-3,3-difluorocyclobutyl)-2-oxopropanoyl]-1,5-dimethylpyrrole-2-carboxamide |
| SMILES | C=CC1(CC(=O)C(=O)c2c(Cl)c(C(=O)Nc3ccc(C)c(C#N)c3)n(C)c2C)CC(F)(F)C1 |
| InChI | InChI=1S/C24H22ClF2N3O3/c1-5-23(11-24(26,27)12-23)9-17(31)21(32)18-14(3)30(4)20(19(18)25)22(33)29-16-7-6-13(2)15(8-16)10-28/h5-8H,1,9,11-12H2,2-4H3,(H,29,33) |
| InChIKey | PLGWVDRZVQWZPX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 91.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.91 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|