C22H20ClFN4O3 — CID 157097904
5-chloro-N-(3-cyano-4-fluorophenyl)-4-[2-[(1-ethenylcyclobutyl)amino]-2-oxoacetyl]-1,3-dimethylpyrrole-2-carboxamide (PubChem CID 157097904) has the molecular formula C22H20ClFN4O3 and a molecular weight of 442.88 g/mol. Its IUPAC name is 5-chloro-N-(3-cyano-4-fluorophenyl)-4-[2-[(1-ethenylcyclobutyl)amino]-2-oxoacetyl]-1,3-dimethylpyrrole-2-carboxamide.
| Compound Name | 5-chloro-N-(3-cyano-4-fluorophenyl)-4-[2-[(1-ethenylcyclobutyl)amino]-2-oxoacetyl]-1,3-dimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 157097904 |
| Molecular Formula | C22H20ClFN4O3 |
| Molecular Weight | 442.88 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 5-chloro-N-(3-cyano-4-fluorophenyl)-4-[2-[(1-ethenylcyclobutyl)amino]-2-oxoacetyl]-1,3-dimethylpyrrole-2-carboxamide |
| SMILES | C=CC1(NC(=O)C(=O)c2c(C)c(C(=O)Nc3ccc(F)c(C#N)c3)n(C)c2Cl)CCC1 |
| InChI | InChI=1S/C22H20ClFN4O3/c1-4-22(8-5-9-22)27-21(31)18(29)16-12(2)17(28(3)19(16)23)20(30)26-14-6-7-15(24)13(10-14)11-25/h4,6-7,10H,1,5,8-9H2,2-3H3,(H,26,30)(H,27,31) |
| InChIKey | OOELVYNERXAMJZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.88 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|