C23H21ClFN3O3 — CID 161441625
5-chloro-N-(3-cyano-4-fluorophenyl)-4-[3-(1-ethenylcyclobutyl)-2-oxopropanoyl]-1,3-dimethylpyrrole-2-carboxamide (PubChem CID 161441625) has the molecular formula C23H21ClFN3O3 and a molecular weight of 441.89 g/mol. Its IUPAC name is 5-chloro-N-(3-cyano-4-fluorophenyl)-4-[3-(1-ethenylcyclobutyl)-2-oxopropanoyl]-1,3-dimethylpyrrole-2-carboxamide.
| Compound Name | 5-chloro-N-(3-cyano-4-fluorophenyl)-4-[3-(1-ethenylcyclobutyl)-2-oxopropanoyl]-1,3-dimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 161441625 |
| Molecular Formula | C23H21ClFN3O3 |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 5-chloro-N-(3-cyano-4-fluorophenyl)-4-[3-(1-ethenylcyclobutyl)-2-oxopropanoyl]-1,3-dimethylpyrrole-2-carboxamide |
| SMILES | C=CC1(CC(=O)C(=O)c2c(C)c(C(=O)Nc3ccc(F)c(C#N)c3)n(C)c2Cl)CCC1 |
| InChI | InChI=1S/C23H21ClFN3O3/c1-4-23(8-5-9-23)11-17(29)20(30)18-13(2)19(28(3)21(18)24)22(31)27-15-6-7-16(25)14(10-15)12-26/h4,6-7,10H,1,5,8-9,11H2,2-3H3,(H,27,31) |
| InChIKey | ZIRVDLQCRTXSTM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 91.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|