C22H20F4N3O7P-2 — CID 155705760
[2-[[2-[5-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoyl]-1,2,4-trimethylpyrrol-3-yl]-2-oxoacetyl]amino]-2-methylbut-3-ynyl] phosphate (PubChem CID 155705760) has the molecular formula C22H20F4N3O7P-2 and a molecular weight of 545.38 g/mol. Its IUPAC name is [2-[[2-[5-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoyl]-1,2,4-trimethylpyrrol-3-yl]-2-oxoacetyl]amino]-2-methylbut-3-ynyl] phosphate.
| Compound Name | [2-[[2-[5-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoyl]-1,2,4-trimethylpyrrol-3-yl]-2-oxoacetyl]amino]-2-methylbut-3-ynyl] phosphate |
|---|---|
| PubChem CID | 155705760 |
| Molecular Formula | C22H20F4N3O7P-2 |
| Molecular Weight | 545.38 g/mol |
| Exact Mass | 545.10 |
| IUPAC Name | [2-[[2-[5-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoyl]-1,2,4-trimethylpyrrol-3-yl]-2-oxoacetyl]amino]-2-methylbut-3-ynyl] phosphate |
| SMILES | C#CC(C)(COP(=O)([O-])[O-])NC(=O)C(=O)c1c(C)c(C(=O)Nc2ccc(F)c(C(F)(F)F)c2)n(C)c1C |
| InChI | InChI=1S/C22H22F4N3O7P/c1-6-21(4,10-36-37(33,34)35)28-20(32)18(30)16-11(2)17(29(5)12(16)3)19(31)27-13-7-8-15(23)14(9-13)22(24,25)26/h1,7-9H,10H2,2-5H3,(H,27,31)(H,28,32)(H2,33,34,35)/p-2 |
| InChIKey | IKRMSQMTQRHBKS-UHFFFAOYSA-L |
| XLogP | 1.59 |
| TPSA | 152.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|