C28H34FN3O5 — CID 157322339
[(2S)-2-ethynyl-5-[5-[(4-fluoro-3-methylphenyl)carbamoyl]-1,2,4-trimethylpyrrol-3-yl]-2-methyl-4,5-dioxopentyl] (2S)-2-amino-3-methylbutanoate (PubChem CID 157322339) has the molecular formula C28H34FN3O5 and a molecular weight of 511.59 g/mol. Its IUPAC name is [(2S)-2-ethynyl-5-[5-[(4-fluoro-3-methylphenyl)carbamoyl]-1,2,4-trimethylpyrrol-3-yl]-2-methyl-4,5-dioxopentyl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2S)-2-ethynyl-5-[5-[(4-fluoro-3-methylphenyl)carbamoyl]-1,2,4-trimethylpyrrol-3-yl]-2-methyl-4,5-dioxopentyl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 157322339 |
| Molecular Formula | C28H34FN3O5 |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | [(2S)-2-ethynyl-5-[5-[(4-fluoro-3-methylphenyl)carbamoyl]-1,2,4-trimethylpyrrol-3-yl]-2-methyl-4,5-dioxopentyl] (2S)-2-amino-3-methylbutanoate |
| SMILES | C#C[C@@](C)(COC(=O)[C@@H](N)C(C)C)CC(=O)C(=O)c1c(C)c(C(=O)Nc2ccc(F)c(C)c2)n(C)c1C |
| InChI | InChI=1S/C28H34FN3O5/c1-9-28(7,14-37-27(36)23(30)15(2)3)13-21(33)25(34)22-17(5)24(32(8)18(22)6)26(35)31-19-10-11-20(29)16(4)12-19/h1,10-12,15,23H,13-14,30H2,2-8H3,(H,31,35)/t23-,28+/m0/s1 |
| InChIKey | BEHVZDUZCTTWOS-NEKDWFFYSA-N |
| XLogP | 3.65 |
| TPSA | 120.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|