C23H25F2N9O4 — CID 146463807
4-[2-[[1-[2-(2-azidoethoxy)ethyl]triazol-4-yl]methylamino]-2-oxoacetyl]-N-(3,4-difluorophenyl)-1,3,5-trimethylpyrrole-2-carboxamide (PubChem CID 146463807) has the molecular formula C23H25F2N9O4 and a molecular weight of 529.51 g/mol. Its IUPAC name is 4-[2-[[1-[2-(2-azidoethoxy)ethyl]triazol-4-yl]methylamino]-2-oxoacetyl]-N-(3,4-difluorophenyl)-1,3,5-trimethylpyrrole-2-carboxamide.
| Compound Name | 4-[2-[[1-[2-(2-azidoethoxy)ethyl]triazol-4-yl]methylamino]-2-oxoacetyl]-N-(3,4-difluorophenyl)-1,3,5-trimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 146463807 |
| Molecular Formula | C23H25F2N9O4 |
| Molecular Weight | 529.51 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 4-[2-[[1-[2-(2-azidoethoxy)ethyl]triazol-4-yl]methylamino]-2-oxoacetyl]-N-(3,4-difluorophenyl)-1,3,5-trimethylpyrrole-2-carboxamide |
| SMILES | Cc1c(C(=O)C(=O)NCc2cn(CCOCCN=[N+]=[N-])nn2)c(C)n(C)c1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C23H25F2N9O4/c1-13-19(14(2)33(3)20(13)22(36)29-15-4-5-17(24)18(25)10-15)21(35)23(37)27-11-16-12-34(32-30-16)7-9-38-8-6-28-31-26/h4-5,10,12H,6-9,11H2,1-3H3,(H,27,37)(H,29,36) |
| InChIKey | KVBDFBXRQWDPMW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 168.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|