C16H15F2N3O3 — CID 153293070
5-[2-(3,4-difluoroanilino)-2-oxoacetyl]-1,2,4-trimethylpyrrole-3-carboxamide (PubChem CID 153293070) has the molecular formula C16H15F2N3O3 and a molecular weight of 335.31 g/mol. Its IUPAC name is 5-[2-(3,4-difluoroanilino)-2-oxoacetyl]-1,2,4-trimethylpyrrole-3-carboxamide.
| Compound Name | 5-[2-(3,4-difluoroanilino)-2-oxoacetyl]-1,2,4-trimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 153293070 |
| Molecular Formula | C16H15F2N3O3 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 5-[2-(3,4-difluoroanilino)-2-oxoacetyl]-1,2,4-trimethylpyrrole-3-carboxamide |
| SMILES | Cc1c(C(N)=O)c(C)n(C)c1C(=O)C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H15F2N3O3/c1-7-12(15(19)23)8(2)21(3)13(7)14(22)16(24)20-9-4-5-10(17)11(18)6-9/h4-6H,1-3H3,(H2,19,23)(H,20,24) |
| InChIKey | ZVZWWLUWVXAPPH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|