C27H32FN3O3 — CID 146449826
5-[2-(2-adamantylamino)-2-oxoacetyl]-N-(4-fluoro-3-methylphenyl)-1,2,4-trimethylpyrrole-3-carboxamide (PubChem CID 146449826) has the molecular formula C27H32FN3O3 and a molecular weight of 465.57 g/mol. Its IUPAC name is 5-[2-(2-adamantylamino)-2-oxoacetyl]-N-(4-fluoro-3-methylphenyl)-1,2,4-trimethylpyrrole-3-carboxamide.
| Compound Name | 5-[2-(2-adamantylamino)-2-oxoacetyl]-N-(4-fluoro-3-methylphenyl)-1,2,4-trimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 146449826 |
| Molecular Formula | C27H32FN3O3 |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 5-[2-(2-adamantylamino)-2-oxoacetyl]-N-(4-fluoro-3-methylphenyl)-1,2,4-trimethylpyrrole-3-carboxamide |
| SMILES | Cc1cc(NC(=O)c2c(C)c(C(=O)C(=O)NC3C4CC5CC(C4)CC3C5)n(C)c2C)ccc1F |
| InChI | InChI=1S/C27H32FN3O3/c1-13-7-20(5-6-21(13)28)29-26(33)22-14(2)24(31(4)15(22)3)25(32)27(34)30-23-18-9-16-8-17(11-18)12-19(23)10-16/h5-7,16-19,23H,8-12H2,1-4H3,(H,29,33)(H,30,34) |
| InChIKey | PXTORVWVUHZAKU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|