C20H18F4N4O3 — CID 155767914
N-(4-fluoro-3-isocyanophenyl)-2,4-dimethyl-5-[2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)acetyl]-1-(trideuteriomethyl)pyrrole-3-carboxamide (PubChem CID 155767914) has the molecular formula C20H18F4N4O3 and a molecular weight of 441.40 g/mol. Its IUPAC name is N-(4-fluoro-3-isocyanophenyl)-2,4-dimethyl-5-[2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)acetyl]-1-(trideuteriomethyl)pyrrole-3-carboxamide.
| Compound Name | N-(4-fluoro-3-isocyanophenyl)-2,4-dimethyl-5-[2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)acetyl]-1-(trideuteriomethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 155767914 |
| Molecular Formula | C20H18F4N4O3 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | N-(4-fluoro-3-isocyanophenyl)-2,4-dimethyl-5-[2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)acetyl]-1-(trideuteriomethyl)pyrrole-3-carboxamide |
| SMILES | [2H]C([2H])([2H])n1c(C)c(C(=O)Nc2ccc(F)c([N+]#[C-])c2)c(C)c1C(=O)C(=O)NC(C)C(F)(F)F |
| InChI | InChI=1S/C20H18F4N4O3/c1-9-15(18(30)27-12-6-7-13(21)14(8-12)25-4)10(2)28(5)16(9)17(29)19(31)26-11(3)20(22,23)24/h6-8,11H,1-3,5H3,(H,26,31)(H,27,30)/i5D3 |
| InChIKey | UMEPGNRNVZQWTI-VPYROQPTSA-N |
| XLogP | 3.83 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|