C24H22FN5O4 — CID 162203704
N-(4-fluoro-3-isocyanophenyl)-4-[3-[3-(1H-imidazol-2-yl)oxetan-3-yl]-2-oxopropanoyl]-1,3,5-trimethylpyrrole-2-carboxamide (PubChem CID 162203704) has the molecular formula C24H22FN5O4 and a molecular weight of 463.47 g/mol. Its IUPAC name is N-(4-fluoro-3-isocyanophenyl)-4-[3-[3-(1H-imidazol-2-yl)oxetan-3-yl]-2-oxopropanoyl]-1,3,5-trimethylpyrrole-2-carboxamide.
| Compound Name | N-(4-fluoro-3-isocyanophenyl)-4-[3-[3-(1H-imidazol-2-yl)oxetan-3-yl]-2-oxopropanoyl]-1,3,5-trimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 162203704 |
| Molecular Formula | C24H22FN5O4 |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | N-(4-fluoro-3-isocyanophenyl)-4-[3-[3-(1H-imidazol-2-yl)oxetan-3-yl]-2-oxopropanoyl]-1,3,5-trimethylpyrrole-2-carboxamide |
| SMILES | [C-]#[N+]c1cc(NC(=O)c2c(C)c(C(=O)C(=O)CC3(c4ncc[nH]4)COC3)c(C)n2C)ccc1F |
| InChI | InChI=1S/C24H22FN5O4/c1-13-19(21(32)18(31)10-24(11-34-12-24)23-27-7-8-28-23)14(2)30(4)20(13)22(33)29-15-5-6-16(25)17(9-15)26-3/h5-9H,10-12H2,1-2,4H3,(H,27,28)(H,29,33) |
| InChIKey | UCANXZHRRQQFDE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|