C20H18BrFN4O4 — CID 155625947
N-(2-bromo-3-fluoro-4-pyridinyl)-4-[2-[(3-ethynyloxetan-3-yl)amino]-2-oxoacetyl]-1,3,5-trimethylpyrrole-2-carboxamide (PubChem CID 155625947) has the molecular formula C20H18BrFN4O4 and a molecular weight of 477.29 g/mol. Its IUPAC name is N-(2-bromo-3-fluoro-4-pyridinyl)-4-[2-[(3-ethynyloxetan-3-yl)amino]-2-oxoacetyl]-1,3,5-trimethylpyrrole-2-carboxamide.
| Compound Name | N-(2-bromo-3-fluoro-4-pyridinyl)-4-[2-[(3-ethynyloxetan-3-yl)amino]-2-oxoacetyl]-1,3,5-trimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 155625947 |
| Molecular Formula | C20H18BrFN4O4 |
| Molecular Weight | 477.29 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | N-(2-bromo-3-fluoro-4-pyridinyl)-4-[2-[(3-ethynyloxetan-3-yl)amino]-2-oxoacetyl]-1,3,5-trimethylpyrrole-2-carboxamide |
| SMILES | C#CC1(NC(=O)C(=O)c2c(C)c(C(=O)Nc3ccnc(Br)c3F)n(C)c2C)COC1 |
| InChI | InChI=1S/C20H18BrFN4O4/c1-5-20(8-30-9-20)25-19(29)16(27)13-10(2)15(26(4)11(13)3)18(28)24-12-6-7-23-17(21)14(12)22/h1,6-7H,8-9H2,2-4H3,(H,25,29)(H,23,24,28) |
| InChIKey | OOIJLKTWTRVEEG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|